C22H26F3N3O3 — CID 112825822
1-(1-benzylpiperidin-4-yl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea (PubChem CID 112825822) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 112825822 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]urea |
| SMILES | COc1ccc(NC(=O)NC2CCN(Cc3ccccc3)CC2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C22H26F3N3O3/c1-30-19-8-7-18(13-20(19)31-15-22(23,24)25)27-21(29)26-17-9-11-28(12-10-17)14-16-5-3-2-4-6-16/h2-8,13,17H,9-12,14-15H2,1H3,(H2,26,27,29) |
| InChIKey | PNEIBLJIGVXAIF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |