C17H25F3N2O3 — CID 112825815
1-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3-(5-methylhexan-2-yl)urea (PubChem CID 112825815) has the molecular formula C17H25F3N2O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3-(5-methylhexan-2-yl)urea.
| Compound Name | 1-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3-(5-methylhexan-2-yl)urea |
|---|---|
| PubChem CID | 112825815 |
| Molecular Formula | C17H25F3N2O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3-(5-methylhexan-2-yl)urea |
| SMILES | COc1ccc(NC(=O)NC(C)CCC(C)C)cc1OCC(F)(F)F |
| InChI | InChI=1S/C17H25F3N2O3/c1-11(2)5-6-12(3)21-16(23)22-13-7-8-14(24-4)15(9-13)25-10-17(18,19)20/h7-9,11-12H,5-6,10H2,1-4H3,(H2,21,22,23) |
| InChIKey | UHAQRDXPDCXEMO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |