C14H17F3N2O5 — CID 122075598
4-[[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]carbamoylamino]butanoic acid (PubChem CID 122075598) has the molecular formula C14H17F3N2O5 and a molecular weight of 350.29 g/mol. Its IUPAC name is 4-[[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122075598 |
| Molecular Formula | C14H17F3N2O5 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]carbamoylamino]butanoic acid |
| SMILES | COc1ccc(NC(=O)NCCCC(=O)O)cc1OCC(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O5/c1-23-10-5-4-9(7-11(10)24-8-14(15,16)17)19-13(22)18-6-2-3-12(20)21/h4-5,7H,2-3,6,8H2,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | YCCVJXYUJIDYFN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|