C13H13F5N2O4 — CID 122092297
4-[[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid (PubChem CID 122092297) has the molecular formula C13H13F5N2O4 and a molecular weight of 356.25 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122092297 |
| Molecular Formula | C13H13F5N2O4 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-[[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccc(OC(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F5N2O4/c14-11(15)24-9-4-3-7(6-8(9)13(16,17)18)20-12(23)19-5-1-2-10(21)22/h3-4,6,11H,1-2,5H2,(H,21,22)(H2,19,20,23) |
| InChIKey | JGHWBCCCVRELRQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|