C13H12N4O3 — CID 107792046
4-[(3,4-dicyanophenyl)carbamoylamino]butanoic acid (PubChem CID 107792046) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-[(3,4-dicyanophenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(3,4-dicyanophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 107792046 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-[(3,4-dicyanophenyl)carbamoylamino]butanoic acid |
| SMILES | N#Cc1ccc(NC(=O)NCCCC(=O)O)cc1C#N |
| InChI | InChI=1S/C13H12N4O3/c14-7-9-3-4-11(6-10(9)8-15)17-13(20)16-5-1-2-12(18)19/h3-4,6H,1-2,5H2,(H,18,19)(H2,16,17,20) |
| InChIKey | HTXMIXHIOJITCD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|