6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid

C15H22N2O3 — CID 61190966

IUPAC6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid
SMILESCc1ccc(NC(=O)NCCCCCC(=O)O)cc1C
InChIInChI=1S/C15H22N2O3/c1-11-7-8-13(10-12(11)2)17-15(20)16-9-5-3-4-6-14(18)19/h7-8,10H,3-6,9H2,1-2H3,(H,18,19)(H2,16,17,20)
InChIKeyQJZQHVCHTKLQHV-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.07
Rot. Bonds7

About 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid

6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid (PubChem CID 61190966) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid.

Molecular Properties

Compound Name6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid
PubChem CID61190966
Molecular FormulaC15H22N2O3
Molecular Weight278.35 g/mol
Exact Mass278.16
IUPAC Name6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid
SMILESCc1ccc(NC(=O)NCCCCCC(=O)O)cc1C
InChIInChI=1S/C15H22N2O3/c1-11-7-8-13(10-12(11)2)17-15(20)16-9-5-3-4-6-14(18)19/h7-8,10H,3-6,9H2,1-2H3,(H,18,19)(H2,16,17,20)
InChIKeyQJZQHVCHTKLQHV-UHFFFAOYSA-N
XLogP3.07
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid?
The IUPAC name of 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid (CID 61190966) is 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid.
What is the SMILES notation for 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid?
The canonical SMILES for 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid is Cc1ccc(NC(=O)NCCCCCC(=O)O)cc1C.
What is the InChIKey of 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid?
The InChIKey is QJZQHVCHTKLQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-11-7-8-13(10-12(11)2)17-15(20)16-9-5-3-4-6-14(18)19/h7-8,10H,3-6,9H2,1-2H3,(H,18,19)(H2,16,17,20).
What are the key properties of 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid?
6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid has a molecular weight of 278.35 g/mol, XLogP of 3.07, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-dimethylphenyl)carbamoylamino]hexanoic acid is sourced from PubChem (CID 61190966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).