C15H22N4O4 — CID 122091932
4-[[5-(ethylcarbamoylamino)-2-methylphenyl]carbamoylamino]butanoic acid (PubChem CID 122091932) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-[[5-(ethylcarbamoylamino)-2-methylphenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[5-(ethylcarbamoylamino)-2-methylphenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122091932 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 4-[[5-(ethylcarbamoylamino)-2-methylphenyl]carbamoylamino]butanoic acid |
| SMILES | CCNC(=O)Nc1ccc(C)c(NC(=O)NCCCC(=O)O)c1 |
| InChI | InChI=1S/C15H22N4O4/c1-3-16-14(22)18-11-7-6-10(2)12(9-11)19-15(23)17-8-4-5-13(20)21/h6-7,9H,3-5,8H2,1-2H3,(H,20,21)(H2,16,18,22)(H2,17,19,23) |
| InChIKey | ZBILDEOIWRTYDG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|