C17H25N3O4 — CID 122080070
4-[[5-(2,2-dimethylpropanoylamino)-2-methylphenyl]carbamoylamino]butanoic acid (PubChem CID 122080070) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-[[5-(2,2-dimethylpropanoylamino)-2-methylphenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[5-(2,2-dimethylpropanoylamino)-2-methylphenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122080070 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 4-[[5-(2,2-dimethylpropanoylamino)-2-methylphenyl]carbamoylamino]butanoic acid |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C)cc1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C17H25N3O4/c1-11-7-8-12(19-15(23)17(2,3)4)10-13(11)20-16(24)18-9-5-6-14(21)22/h7-8,10H,5-6,9H2,1-4H3,(H,19,23)(H,21,22)(H2,18,20,24) |
| InChIKey | HUAZJZVJUMAISO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|