C14H16F3N3O4 — CID 122075194
4-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid (PubChem CID 122075194) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is 4-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122075194 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
| SMILES | CC(=O)Nc1ccc(NC(=O)NCCCC(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3N3O4/c1-8(21)19-9-4-5-11(10(7-9)14(15,16)17)20-13(24)18-6-2-3-12(22)23/h4-5,7H,2-3,6H2,1H3,(H,19,21)(H,22,23)(H2,18,20,24) |
| InChIKey | LWXNAOVGLXYHLW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|