C29H30ClF3N4O3 — CID 162652621
N-[4-[1-(4-acetamidophenyl)-5-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]pentyl]phenyl]acetamide (PubChem CID 162652621) has the molecular formula C29H30ClF3N4O3 and a molecular weight of 575.03 g/mol. Its IUPAC name is N-[4-[1-(4-acetamidophenyl)-5-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]pentyl]phenyl]acetamide.
| Compound Name | N-[4-[1-(4-acetamidophenyl)-5-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]pentyl]phenyl]acetamide |
|---|---|
| PubChem CID | 162652621 |
| Molecular Formula | C29H30ClF3N4O3 |
| Molecular Weight | 575.03 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | N-[4-[1-(4-acetamidophenyl)-5-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]pentyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(CCCCNC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C29H30ClF3N4O3/c1-18(38)35-22-10-6-20(7-11-22)25(21-8-12-23(13-9-21)36-19(2)39)5-3-4-16-34-28(40)37-24-14-15-27(30)26(17-24)29(31,32)33/h6-15,17,25H,3-5,16H2,1-2H3,(H,35,38)(H,36,39)(H2,34,37,40) |
| InChIKey | MIAJHXAOYMGJHD-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.03 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|