C16H19Cl2F3N2O2 — CID 126612619
N-butyl-2-(2-chloroethyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 126612619) has the molecular formula C16H19Cl2F3N2O2 and a molecular weight of 399.24 g/mol. Its IUPAC name is N-butyl-2-(2-chloroethyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-butyl-2-(2-chloroethyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 126612619 |
| Molecular Formula | C16H19Cl2F3N2O2 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-butyl-2-(2-chloroethyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CCCCNC(=O)C(CCCl)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19Cl2F3N2O2/c1-2-3-8-22-14(24)11(6-7-17)15(25)23-10-4-5-13(18)12(9-10)16(19,20)21/h4-5,9,11H,2-3,6-8H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | CLJQKXNTXPFANQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|