C13H13ClF3NO3 — CID 18270404
[1-[4-chloro-3-(trifluoromethyl)anilino]-1-oxopropan-2-yl] propanoate (PubChem CID 18270404) has the molecular formula C13H13ClF3NO3 and a molecular weight of 323.70 g/mol. Its IUPAC name is [1-[4-chloro-3-(trifluoromethyl)anilino]-1-oxopropan-2-yl] propanoate.
| Compound Name | [1-[4-chloro-3-(trifluoromethyl)anilino]-1-oxopropan-2-yl] propanoate |
|---|---|
| PubChem CID | 18270404 |
| Molecular Formula | C13H13ClF3NO3 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | [1-[4-chloro-3-(trifluoromethyl)anilino]-1-oxopropan-2-yl] propanoate |
| SMILES | CCC(=O)OC(C)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13ClF3NO3/c1-3-11(19)21-7(2)12(20)18-8-4-5-10(14)9(6-8)13(15,16)17/h4-7H,3H2,1-2H3,(H,18,20) |
| InChIKey | QIQOUTHQIAVJDQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |