C12H12BrClF3NO — CID 43245822
2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutanamide (PubChem CID 43245822) has the molecular formula C12H12BrClF3NO and a molecular weight of 358.59 g/mol. Its IUPAC name is 2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutanamide.
| Compound Name | 2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 43245822 |
| Molecular Formula | C12H12BrClF3NO |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12BrClF3NO/c1-6(2)10(13)11(19)18-7-3-4-9(14)8(5-7)12(15,16)17/h3-6,10H,1-2H3,(H,18,19) |
| InChIKey | GEVNKOKNCYUJFP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|