C10H9ClF3NO2 — CID 82134049
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide (PubChem CID 82134049) has the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 82134049 |
| Molecular Formula | C10H9ClF3NO2 |
| Molecular Weight | 267.63 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
| SMILES | CC(O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF3NO2/c1-5(16)9(17)15-6-2-3-8(11)7(4-6)10(12,13)14/h2-5,16H,1H3,(H,15,17) |
| InChIKey | HJDPPGZWVYZPQP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |