C19H19ClF3N3O2 — CID 139036224
N-butyl-4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 139036224) has the molecular formula C19H19ClF3N3O2 and a molecular weight of 413.83 g/mol. Its IUPAC name is N-butyl-4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-butyl-4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 139036224 |
| Molecular Formula | C19H19ClF3N3O2 |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-butyl-4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | CCCCNC(=O)c1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H19ClF3N3O2/c1-2-3-10-24-17(27)12-4-6-13(7-5-12)25-18(28)26-14-8-9-16(20)15(11-14)19(21,22)23/h4-9,11H,2-3,10H2,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | BMQFPAKYWPWPMZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|