C18H18Cl2N2O2 — CID 109043815
1-N-butyl-4-N-(3,4-dichlorophenyl)benzene-1,4-dicarboxamide (PubChem CID 109043815) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-N-butyl-4-N-(3,4-dichlorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-butyl-4-N-(3,4-dichlorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109043815 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-N-butyl-4-N-(3,4-dichlorophenyl)benzene-1,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-2-3-10-21-17(23)12-4-6-13(7-5-12)18(24)22-14-8-9-15(19)16(20)11-14/h4-9,11H,2-3,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | LAQSHFUPLQTPMR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|