C16H20ClF3N2O3 — CID 108506520
N-(3-butoxypropyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]oxamide (PubChem CID 108506520) has the molecular formula C16H20ClF3N2O3 and a molecular weight of 380.79 g/mol. Its IUPAC name is N-(3-butoxypropyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(3-butoxypropyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108506520 |
| Molecular Formula | C16H20ClF3N2O3 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-(3-butoxypropyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
| SMILES | CCCCOCCCNC(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20ClF3N2O3/c1-2-3-8-25-9-4-7-21-14(23)15(24)22-11-5-6-13(17)12(10-11)16(18,19)20/h5-6,10H,2-4,7-9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | CPWMHDNSHDLBMP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|