C14H17ClF3N3O2 — CID 108515808
N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propyl]oxamide (PubChem CID 108515808) has the molecular formula C14H17ClF3N3O2 and a molecular weight of 351.76 g/mol. Its IUPAC name is N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propyl]oxamide.
| Compound Name | N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propyl]oxamide |
|---|---|
| PubChem CID | 108515808 |
| Molecular Formula | C14H17ClF3N3O2 |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N'-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propyl]oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17ClF3N3O2/c1-21(2)7-3-6-19-12(22)13(23)20-9-4-5-11(15)10(8-9)14(16,17)18/h4-5,8H,3,6-7H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | GZHLNJULVPHNKF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|