C14H20BrN3O2 — CID 47148089
N'-(4-bromo-3-methylphenyl)-N-[3-(dimethylamino)propyl]oxamide (PubChem CID 47148089) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is N'-(4-bromo-3-methylphenyl)-N-[3-(dimethylamino)propyl]oxamide.
| Compound Name | N'-(4-bromo-3-methylphenyl)-N-[3-(dimethylamino)propyl]oxamide |
|---|---|
| PubChem CID | 47148089 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N'-(4-bromo-3-methylphenyl)-N-[3-(dimethylamino)propyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCCCN(C)C)ccc1Br |
| InChI | InChI=1S/C14H20BrN3O2/c1-10-9-11(5-6-12(10)15)17-14(20)13(19)16-7-4-8-18(2)3/h5-6,9H,4,7-8H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | PHTCNLKGLRVFRQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|