C13H18N4O4 — CID 7584694
N-[3-(dimethylamino)propyl]-N'-(4-nitrophenyl)oxamide (PubChem CID 7584694) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N'-(4-nitrophenyl)oxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N'-(4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 7584694 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N'-(4-nitrophenyl)oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18N4O4/c1-16(2)9-3-8-14-12(18)13(19)15-10-4-6-11(7-5-10)17(20)21/h4-7H,3,8-9H2,1-2H3,(H,14,18)(H,15,19) |
| InChIKey | FUCBYGOTRKIRMI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|