C20H24N6O6 — CID 136817257
1-(4-nitrophenyl)-3-[6-[(4-nitrophenyl)carbamoylamino]hexyl]urea (PubChem CID 136817257) has the molecular formula C20H24N6O6 and a molecular weight of 444.45 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-[6-[(4-nitrophenyl)carbamoylamino]hexyl]urea.
| Compound Name | 1-(4-nitrophenyl)-3-[6-[(4-nitrophenyl)carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 136817257 |
| Molecular Formula | C20H24N6O6 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-(4-nitrophenyl)-3-[6-[(4-nitrophenyl)carbamoylamino]hexyl]urea |
| SMILES | O=C(NCCCCCCNC(=O)Nc1ccc([N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H24N6O6/c27-19(23-15-5-9-17(10-6-15)25(29)30)21-13-3-1-2-4-14-22-20(28)24-16-7-11-18(12-8-16)26(31)32/h5-12H,1-4,13-14H2,(H2,21,23,27)(H2,22,24,28) |
| InChIKey | UDAAKIDZZSFQMN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|