C12H14N4O5 — CID 108513182
N-(3-formamidopropyl)-N'-(4-nitrophenyl)oxamide (PubChem CID 108513182) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is N-(3-formamidopropyl)-N'-(4-nitrophenyl)oxamide.
| Compound Name | N-(3-formamidopropyl)-N'-(4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 108513182 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(3-formamidopropyl)-N'-(4-nitrophenyl)oxamide |
| SMILES | O=CNCCCNC(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N4O5/c17-8-13-6-1-7-14-11(18)12(19)15-9-2-4-10(5-3-9)16(20)21/h2-5,8H,1,6-7H2,(H,13,17)(H,14,18)(H,15,19) |
| InChIKey | QJHXVQDAUXDEPQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|