C12H16N4O5S — CID 108508777
N-(3-formamidopropyl)-N'-(4-sulfamoylphenyl)oxamide (PubChem CID 108508777) has the molecular formula C12H16N4O5S and a molecular weight of 328.35 g/mol. Its IUPAC name is N-(3-formamidopropyl)-N'-(4-sulfamoylphenyl)oxamide.
| Compound Name | N-(3-formamidopropyl)-N'-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508777 |
| Molecular Formula | C12H16N4O5S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-(3-formamidopropyl)-N'-(4-sulfamoylphenyl)oxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(=O)NCCCNC=O)cc1 |
| InChI | InChI=1S/C12H16N4O5S/c13-22(20,21)10-4-2-9(3-5-10)16-12(19)11(18)15-7-1-6-14-8-17/h2-5,8H,1,6-7H2,(H,14,17)(H,15,18)(H,16,19)(H2,13,20,21) |
| InChIKey | FQSDGVJXEBXMCR-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|