C11H14BrN3O2 — CID 108869282
N-[3-[(4-bromophenyl)carbamoylamino]propyl]formamide (PubChem CID 108869282) has the molecular formula C11H14BrN3O2 and a molecular weight of 300.16 g/mol. Its IUPAC name is N-[3-[(4-bromophenyl)carbamoylamino]propyl]formamide.
| Compound Name | N-[3-[(4-bromophenyl)carbamoylamino]propyl]formamide |
|---|---|
| PubChem CID | 108869282 |
| Molecular Formula | C11H14BrN3O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | N-[3-[(4-bromophenyl)carbamoylamino]propyl]formamide |
| SMILES | O=CNCCCNC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrN3O2/c12-9-2-4-10(5-3-9)15-11(17)14-7-1-6-13-8-16/h2-5,8H,1,6-7H2,(H,13,16)(H2,14,15,17) |
| InChIKey | UUMRBWTVAGTVKV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|