C11H13BrClF3N2OS — CID 173029098
1-(4-bromophenyl)-3-[3-(trifluoromethylsulfanyl)propyl]urea;hydrochloride (PubChem CID 173029098) has the molecular formula C11H13BrClF3N2OS and a molecular weight of 393.66 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[3-(trifluoromethylsulfanyl)propyl]urea;hydrochloride.
| Compound Name | 1-(4-bromophenyl)-3-[3-(trifluoromethylsulfanyl)propyl]urea;hydrochloride |
|---|---|
| PubChem CID | 173029098 |
| Molecular Formula | C11H13BrClF3N2OS |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 1-(4-bromophenyl)-3-[3-(trifluoromethylsulfanyl)propyl]urea;hydrochloride |
| SMILES | Cl.O=C(NCCCSC(F)(F)F)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrF3N2OS.ClH/c12-8-2-4-9(5-3-8)17-10(18)16-6-1-7-19-11(13,14)15;/h2-5H,1,6-7H2,(H2,16,17,18);1H |
| InChIKey | WLLLWUYIMCYXNG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|