C22H27BrF3N5O2 — CID 68923663
1-[3-[(4-bromophenyl)carbamoylamino]propyl]-1-[2-(dimethylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 68923663) has the molecular formula C22H27BrF3N5O2 and a molecular weight of 530.39 g/mol. Its IUPAC name is 1-[3-[(4-bromophenyl)carbamoylamino]propyl]-1-[2-(dimethylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[(4-bromophenyl)carbamoylamino]propyl]-1-[2-(dimethylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 68923663 |
| Molecular Formula | C22H27BrF3N5O2 |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 1-[3-[(4-bromophenyl)carbamoylamino]propyl]-1-[2-(dimethylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CN(C)CCN(CCCNC(=O)Nc1ccc(Br)cc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27BrF3N5O2/c1-30(2)14-15-31(21(33)29-19-8-4-16(5-9-19)22(24,25)26)13-3-12-27-20(32)28-18-10-6-17(23)7-11-18/h4-11H,3,12-15H2,1-2H3,(H,29,33)(H2,27,28,32) |
| InChIKey | QCJYEYCYVWELRR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|