C20H22F3N3O2 — CID 109053461
1-N-[3-(dimethylamino)propyl]-3-N-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 109053461) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-3-N-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-3-N-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109053461 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-3-N-[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(C(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-26(2)12-4-11-24-18(27)14-5-3-6-15(13-14)19(28)25-17-9-7-16(8-10-17)20(21,22)23/h3,5-10,13H,4,11-12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | YDJPXEKFKZREDR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|