C18H21F3N4O — CID 109168255
N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)anilino]pyridine-4-carboxamide (PubChem CID 109168255) has the molecular formula C18H21F3N4O and a molecular weight of 366.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)anilino]pyridine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)anilino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109168255 |
| Molecular Formula | C18H21F3N4O |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)anilino]pyridine-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccnc(Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H21F3N4O/c1-25(2)10-4-8-23-17(26)13-7-9-22-16(11-13)24-15-6-3-5-14(12-15)18(19,20)21/h3,5-7,9,11-12H,4,8,10H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | YSYMPOSMUDOPTO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|