C17H20Cl2N4O — CID 109168292
2-(2,6-dichloroanilino)-N-[3-(dimethylamino)propyl]pyridine-4-carboxamide (PubChem CID 109168292) has the molecular formula C17H20Cl2N4O and a molecular weight of 367.28 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-N-[3-(dimethylamino)propyl]pyridine-4-carboxamide.
| Compound Name | 2-(2,6-dichloroanilino)-N-[3-(dimethylamino)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109168292 |
| Molecular Formula | C17H20Cl2N4O |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-(2,6-dichloroanilino)-N-[3-(dimethylamino)propyl]pyridine-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccnc(Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N4O/c1-23(2)10-4-8-21-17(24)12-7-9-20-15(11-12)22-16-13(18)5-3-6-14(16)19/h3,5-7,9,11H,4,8,10H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | QQGUKABTRNVKNL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|