C14H24N4O — CID 55042326
N-[3-(dimethylamino)propyl]-2-(propylamino)pyridine-4-carboxamide (PubChem CID 55042326) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(propylamino)pyridine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55042326 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)NCCCN(C)C)ccn1 |
| InChI | InChI=1S/C14H24N4O/c1-4-7-15-13-11-12(6-9-16-13)14(19)17-8-5-10-18(2)3/h6,9,11H,4-5,7-8,10H2,1-3H3,(H,15,16)(H,17,19) |
| InChIKey | ODMYCIHWZHVGFL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|