C13H20N4O2 — CID 55046885
N-(4-amino-4-oxobutyl)-2-(propylamino)pyridine-4-carboxamide (PubChem CID 55046885) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-2-(propylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-2-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55046885 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-2-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)NCCCC(N)=O)ccn1 |
| InChI | InChI=1S/C13H20N4O2/c1-2-6-15-12-9-10(5-8-16-12)13(19)17-7-3-4-11(14)18/h5,8-9H,2-4,6-7H2,1H3,(H2,14,18)(H,15,16)(H,17,19) |
| InChIKey | KUANVVJVUGQQKS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|