C20H25N5O3 — CID 109104366
5-N-(4-acetamidophenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide (PubChem CID 109104366) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 5-N-(4-acetamidophenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(4-acetamidophenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109104366 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 5-N-(4-acetamidophenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cncc(C(=O)NCCCN(C)C)c2)cc1 |
| InChI | InChI=1S/C20H25N5O3/c1-14(26)23-17-5-7-18(8-6-17)24-20(28)16-11-15(12-21-13-16)19(27)22-9-4-10-25(2)3/h5-8,11-13H,4,9-10H2,1-3H3,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | LOUDBKXGTYLKEZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|