C19H22N4O3 — CID 109102049
5-N-(3-acetamidophenyl)-3-N-butylpyridine-3,5-dicarboxamide (PubChem CID 109102049) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-N-(3-acetamidophenyl)-3-N-butylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(3-acetamidophenyl)-3-N-butylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109102049 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-N-(3-acetamidophenyl)-3-N-butylpyridine-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1cncc(C(=O)Nc2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C19H22N4O3/c1-3-4-8-21-18(25)14-9-15(12-20-11-14)19(26)23-17-7-5-6-16(10-17)22-13(2)24/h5-7,9-12H,3-4,8H2,1-2H3,(H,21,25)(H,22,24)(H,23,26) |
| InChIKey | ASJLEXMIMKGKGK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|