C22H30N4O2 — CID 109104332
5-N-(2,6-diethylphenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide (PubChem CID 109104332) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 5-N-(2,6-diethylphenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(2,6-diethylphenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109104332 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 5-N-(2,6-diethylphenyl)-3-N-[3-(dimethylamino)propyl]pyridine-3,5-dicarboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cncc(C(=O)NCCCN(C)C)c1 |
| InChI | InChI=1S/C22H30N4O2/c1-5-16-9-7-10-17(6-2)20(16)25-22(28)19-13-18(14-23-15-19)21(27)24-11-8-12-26(3)4/h7,9-10,13-15H,5-6,8,11-12H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | KZFAEXZASWBFJF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|