C21H28N4O2 — CID 109104300
5-N-[3-(dimethylamino)propyl]-3-N-(3-phenylpropyl)pyridine-3,5-dicarboxamide (PubChem CID 109104300) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-N-[3-(dimethylamino)propyl]-3-N-(3-phenylpropyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-[3-(dimethylamino)propyl]-3-N-(3-phenylpropyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109104300 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 5-N-[3-(dimethylamino)propyl]-3-N-(3-phenylpropyl)pyridine-3,5-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1cncc(C(=O)NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C21H28N4O2/c1-25(2)13-7-12-24-21(27)19-14-18(15-22-16-19)20(26)23-11-6-10-17-8-4-3-5-9-17/h3-5,8-9,14-16H,6-7,10-13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | BWEUQJLYANSPMN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|