C18H24N6O2 — CID 109253432
2-(4-acetamidoanilino)-N-[3-(dimethylamino)propyl]pyrimidine-5-carboxamide (PubChem CID 109253432) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-(4-acetamidoanilino)-N-[3-(dimethylamino)propyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(4-acetamidoanilino)-N-[3-(dimethylamino)propyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109253432 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-(4-acetamidoanilino)-N-[3-(dimethylamino)propyl]pyrimidine-5-carboxamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncc(C(=O)NCCCN(C)C)cn2)cc1 |
| InChI | InChI=1S/C18H24N6O2/c1-13(25)22-15-5-7-16(8-6-15)23-18-20-11-14(12-21-18)17(26)19-9-4-10-24(2)3/h5-8,11-12H,4,9-10H2,1-3H3,(H,19,26)(H,22,25)(H,20,21,23) |
| InChIKey | HPZUOCKRODLVIX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|