C22H29N3O3 — CID 109053455
1-N-[3-(dimethylamino)propyl]-3-N-(4-propan-2-yloxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 109053455) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-3-N-(4-propan-2-yloxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-3-N-(4-propan-2-yloxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109053455 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-3-N-(4-propan-2-yloxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | CC(C)Oc1ccc(NC(=O)c2cccc(C(=O)NCCCN(C)C)c2)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-16(2)28-20-11-9-19(10-12-20)24-22(27)18-8-5-7-17(15-18)21(26)23-13-6-14-25(3)4/h5,7-12,15-16H,6,13-14H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | SOCQVEWORNNBSK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|