C18H27F3N4O3 — CID 141120602
2-[3-(diethylamino)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethylcarbamic acid (PubChem CID 141120602) has the molecular formula C18H27F3N4O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-[3-(diethylamino)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethylcarbamic acid.
| Compound Name | 2-[3-(diethylamino)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 141120602 |
| Molecular Formula | C18H27F3N4O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[3-(diethylamino)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethylcarbamic acid |
| SMILES | CCN(CC)CCCN(CCNC(=O)O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H27F3N4O3/c1-3-24(4-2)11-5-12-25(13-10-22-17(27)28)16(26)23-15-8-6-14(7-9-15)18(19,20)21/h6-9,22H,3-5,10-13H2,1-2H3,(H,23,26)(H,27,28) |
| InChIKey | MOHGGWAWAGYGTG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |