C27H39F3N6OS — CID 87623426
1-[2-(diethylamino)ethyl]-1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 87623426) has the molecular formula C27H39F3N6OS and a molecular weight of 552.71 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(diethylamino)ethyl]-1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87623426 |
| Molecular Formula | C27H39F3N6OS |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-1-[2-[[4-(diethylamino)phenyl]carbamothioylamino]ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CCN(CC)CCN(CCNC(=S)Nc1ccc(N(CC)CC)cc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H39F3N6OS/c1-5-34(6-2)19-20-36(26(37)33-23-11-9-21(10-12-23)27(28,29)30)18-17-31-25(38)32-22-13-15-24(16-14-22)35(7-3)8-4/h9-16H,5-8,17-20H2,1-4H3,(H,33,37)(H2,31,32,38) |
| InChIKey | VGROAEFWLDQIIN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|