C16H19F6N3O2 — CID 108522216
N'-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]oxamide (PubChem CID 108522216) has the molecular formula C16H19F6N3O2 and a molecular weight of 399.34 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]oxamide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 108522216 |
| Molecular Formula | C16H19F6N3O2 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]oxamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F6N3O2/c1-3-25(4-2)6-5-23-13(26)14(27)24-12-8-10(15(17,18)19)7-11(9-12)16(20,21)22/h7-9H,3-6H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | CLCATAYMXFVMHX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|