C18H14F6N2O2 — CID 108523144
N'-[3,5-bis(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)oxamide (PubChem CID 108523144) has the molecular formula C18H14F6N2O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)oxamide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108523144 |
| Molecular Formula | C18H14F6N2O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C18H14F6N2O2/c1-9-3-4-13(5-10(9)2)25-15(27)16(28)26-14-7-11(17(19,20)21)6-12(8-14)18(22,23)24/h3-8H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ONTJPFDAXUGZGM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|