C15H9F6N3O2 — CID 86807604
N'-[3,5-bis(trifluoromethyl)phenyl]-N-pyridin-3-yloxamide (PubChem CID 86807604) has the molecular formula C15H9F6N3O2 and a molecular weight of 377.24 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-N-pyridin-3-yloxamide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-pyridin-3-yloxamide |
|---|---|
| PubChem CID | 86807604 |
| Molecular Formula | C15H9F6N3O2 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-pyridin-3-yloxamide |
| SMILES | O=C(Nc1cccnc1)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F6N3O2/c16-14(17,18)8-4-9(15(19,20)21)6-11(5-8)24-13(26)12(25)23-10-2-1-3-22-7-10/h1-7H,(H,23,25)(H,24,26) |
| InChIKey | YTWSVVFOTJSCSQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|