C16H14F3N3O2 — CID 86805127
N-pyridin-3-yl-N'-[3-(3,3,3-trifluoropropyl)phenyl]oxamide (PubChem CID 86805127) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is N-pyridin-3-yl-N'-[3-(3,3,3-trifluoropropyl)phenyl]oxamide.
| Compound Name | N-pyridin-3-yl-N'-[3-(3,3,3-trifluoropropyl)phenyl]oxamide |
|---|---|
| PubChem CID | 86805127 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-pyridin-3-yl-N'-[3-(3,3,3-trifluoropropyl)phenyl]oxamide |
| SMILES | O=C(Nc1cccnc1)C(=O)Nc1cccc(CCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3N3O2/c17-16(18,19)7-6-11-3-1-4-12(9-11)21-14(23)15(24)22-13-5-2-8-20-10-13/h1-5,8-10H,6-7H2,(H,21,23)(H,22,24) |
| InChIKey | LEEGAANXLGUHDG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|