C13H16N2O3 — CID 10944780
5,5-dimethyl-2,4-dioxo-N-pyridin-3-ylhexanamide (PubChem CID 10944780) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5,5-dimethyl-2,4-dioxo-N-pyridin-3-ylhexanamide.
| Compound Name | 5,5-dimethyl-2,4-dioxo-N-pyridin-3-ylhexanamide |
|---|---|
| PubChem CID | 10944780 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 5,5-dimethyl-2,4-dioxo-N-pyridin-3-ylhexanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C13H16N2O3/c1-13(2,3)11(17)7-10(16)12(18)15-9-5-4-6-14-8-9/h4-6,8H,7H2,1-3H3,(H,15,18) |
| InChIKey | YQSGVDFUTXSQMR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|