C12H18N2O — CID 71023963
(4S)-2,2-dimethyl-4-(pyridin-3-ylamino)pentan-3-one (PubChem CID 71023963) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-(pyridin-3-ylamino)pentan-3-one.
| Compound Name | (4S)-2,2-dimethyl-4-(pyridin-3-ylamino)pentan-3-one |
|---|---|
| PubChem CID | 71023963 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (4S)-2,2-dimethyl-4-(pyridin-3-ylamino)pentan-3-one |
| SMILES | C[C@H](Nc1cccnc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H18N2O/c1-9(11(15)12(2,3)4)14-10-6-5-7-13-8-10/h5-9,14H,1-4H3/t9-/m0/s1 |
| InChIKey | RJKWHVICTDVIBE-VIFPVBQESA-N |
| XLogP | 2.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |