C11H16N2O — CID 142960765
3-methyl-N-pyridin-3-ylpentanamide (PubChem CID 142960765) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-methyl-N-pyridin-3-ylpentanamide.
| Compound Name | 3-methyl-N-pyridin-3-ylpentanamide |
|---|---|
| PubChem CID | 142960765 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-methyl-N-pyridin-3-ylpentanamide |
| SMILES | CCC(C)CC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C11H16N2O/c1-3-9(2)7-11(14)13-10-5-4-6-12-8-10/h4-6,8-9H,3,7H2,1-2H3,(H,13,14) |
| InChIKey | KHUGXNMPDCZSTR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |