C11H18N2O — CID 166133137
3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen (PubChem CID 166133137) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen.
| Compound Name | 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen |
|---|---|
| PubChem CID | 166133137 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen |
| SMILES | CCC(C)CC(=O)Nc1cccnc1.[H][H] |
| InChI | InChI=1S/C11H16N2O.H2/c1-3-9(2)7-11(14)13-10-5-4-6-12-8-10;/h4-6,8-9H,3,7H2,1-2H3,(H,13,14);1H |
| InChIKey | HBUIYAVCAZISOF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |