3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen

C11H18N2O — CID 166133137

IUPAC3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen
SMILESCCC(C)CC(=O)Nc1cccnc1.[H][H]
InChIInChI=1S/C11H16N2O.H2/c1-3-9(2)7-11(14)13-10-5-4-6-12-8-10;/h4-6,8-9H,3,7H2,1-2H3,(H,13,14);1H
InChIKeyHBUIYAVCAZISOF-UHFFFAOYSA-N
MW194.28 g/mol
LogP2.70
Rot. Bonds4

About 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen

3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen (PubChem CID 166133137) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen.

Molecular Properties

Compound Name3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen
PubChem CID166133137
Molecular FormulaC11H18N2O
Molecular Weight194.28 g/mol
Exact Mass194.14
IUPAC Name3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen
SMILESCCC(C)CC(=O)Nc1cccnc1.[H][H]
InChIInChI=1S/C11H16N2O.H2/c1-3-9(2)7-11(14)13-10-5-4-6-12-8-10;/h4-6,8-9H,3,7H2,1-2H3,(H,13,14);1H
InChIKeyHBUIYAVCAZISOF-UHFFFAOYSA-N
XLogP2.70
TPSA41.99 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.28
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen?
The IUPAC name of 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen (CID 166133137) is 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen.
What is the SMILES notation for 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen?
The canonical SMILES for 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen is CCC(C)CC(=O)Nc1cccnc1.[H][H].
What is the InChIKey of 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen?
The InChIKey is HBUIYAVCAZISOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O.H2/c1-3-9(2)7-11(14)13-10-5-4-6-12-8-10;/h4-6,8-9H,3,7H2,1-2H3,(H,13,14);1H.
What are the key properties of 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen?
3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen has a molecular weight of 194.28 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-pyridin-3-ylpentanamide;molecular hydrogen is sourced from PubChem (CID 166133137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).