C7H6F2N2O — CID 103600571
2,2-difluoro-N-pyridin-3-ylacetamide (PubChem CID 103600571) has the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. Its IUPAC name is 2,2-difluoro-N-pyridin-3-ylacetamide.
| Compound Name | 2,2-difluoro-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 103600571 |
| Molecular Formula | C7H6F2N2O |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2,2-difluoro-N-pyridin-3-ylacetamide |
| SMILES | O=C(Nc1cccnc1)C(F)F |
| InChI | InChI=1S/C7H6F2N2O/c8-6(9)7(12)11-5-2-1-3-10-4-5/h1-4,6H,(H,11,12) |
| InChIKey | JTJNNYKFVJNZIX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |