About boric acid;pyridin-3-ylurea
boric acid;pyridin-3-ylurea (PubChem CID 175497836) has the molecular formula C6H10BN3O4
and a molecular weight of 198.98 g/mol. Its IUPAC name is boric acid;pyridin-3-ylurea.
Molecular Properties
| Compound Name | boric acid;pyridin-3-ylurea |
| PubChem CID | 175497836 |
| Molecular Formula | C6H10BN3O4 |
| Molecular Weight | 198.98 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | boric acid;pyridin-3-ylurea |
| SMILES | NC(=O)Nc1cccnc1.OB(O)O |
| InChI | InChI=1S/C6H7N3O.BH3O3/c7-6(10)9-5-2-1-3-8-4-5;2-1(3)4/h1-4H,(H3,7,9,10);2-4H |
| InChIKey | HMNMZPDNDGCBQI-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.98 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;pyridin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;pyridin-3-ylurea?
The IUPAC name of boric acid;pyridin-3-ylurea (CID 175497836) is boric acid;pyridin-3-ylurea.
What is the SMILES notation for boric acid;pyridin-3-ylurea?
The canonical SMILES for boric acid;pyridin-3-ylurea is NC(=O)Nc1cccnc1.OB(O)O.
What is the InChIKey of boric acid;pyridin-3-ylurea?
The InChIKey is HMNMZPDNDGCBQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O.BH3O3/c7-6(10)9-5-2-1-3-8-4-5;2-1(3)4/h1-4H,(H3,7,9,10);2-4H.
What are the key properties of boric acid;pyridin-3-ylurea?
boric acid;pyridin-3-ylurea has a molecular weight of 198.98 g/mol, XLogP of -1.48, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;pyridin-3-ylurea is sourced from PubChem (CID 175497836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).