About 1-methylpyrrolidine;pyridin-3-ylurea
1-methylpyrrolidine;pyridin-3-ylurea (PubChem CID 143564599) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-methylpyrrolidine;pyridin-3-ylurea.
Molecular Properties
| Compound Name | 1-methylpyrrolidine;pyridin-3-ylurea |
| PubChem CID | 143564599 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-methylpyrrolidine;pyridin-3-ylurea |
| SMILES | CN1CCCC1.NC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C6H7N3O.C5H11N/c7-6(10)9-5-2-1-3-8-4-5;1-6-4-2-3-5-6/h1-4H,(H3,7,9,10);2-5H2,1H3 |
| InChIKey | XPWBSDPLDYTEQC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpyrrolidine;pyridin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidine;pyridin-3-ylurea?
The IUPAC name of 1-methylpyrrolidine;pyridin-3-ylurea (CID 143564599) is 1-methylpyrrolidine;pyridin-3-ylurea.
What is the SMILES notation for 1-methylpyrrolidine;pyridin-3-ylurea?
The canonical SMILES for 1-methylpyrrolidine;pyridin-3-ylurea is CN1CCCC1.NC(=O)Nc1cccnc1.
What is the InChIKey of 1-methylpyrrolidine;pyridin-3-ylurea?
The InChIKey is XPWBSDPLDYTEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O.C5H11N/c7-6(10)9-5-2-1-3-8-4-5;1-6-4-2-3-5-6/h1-4H,(H3,7,9,10);2-5H2,1H3.
What are the key properties of 1-methylpyrrolidine;pyridin-3-ylurea?
1-methylpyrrolidine;pyridin-3-ylurea has a molecular weight of 222.29 g/mol, XLogP of 1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidine;pyridin-3-ylurea is sourced from PubChem (CID 143564599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).